Amino-PEG10-Boc, 99.89%
cas: 1818294-42-6 — see every product listed under this CAS number, including other names
Amino-PEG10-Boc, 99.89% (CAS 1818294-42-6) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 250 mg, 500 mg, 100 mg, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-140196-1 g |
| cas | 1818294-42-6 |
| size | 1 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 1281.00 Pln | |
| MedChemExpress | 250 mg | 417.22 Pln | |
| MedChemExpress | 500 mg | 705.14 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 5 g | 4197.43 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.89% |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1818294-42-6) is a chemical compound with the molecular formula C27H55NO12 and a molecular weight of 585.7 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: CXGGTGCHTQMBOC-UHFFFAOYSA-N.
| Molecular formula | C27H55NO12 |
|---|---|
| Molecular weight | 585.7 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | CXGGTGCHTQMBOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)