cas: 2055014-98-5 — see every product listed under this CAS number, including other names
4,7,10,17,20,23-Hexaoxa-13,14-dithiahexacosanedioic acid, 95%, 95% (CAS 2055014-98-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120E2T-100mg |
| cas | 2055014-98-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 250mg | 606.80 Pln | |
| Chemat | 1g | 1691.60 Pln | |
| Chemat | 50mg | 299.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethyldisulfanyl]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2055014-98-5) is a chemical compound with the molecular formula C18H34O10S2 and a molecular weight of 474.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethyldisulfanyl]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: DLBWMEFQLZTRTD-UHFFFAOYSA-N.
| Molecular formula | C18H34O10S2 |
|---|---|
| Molecular weight | 474.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethyldisulfanyl]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | DLBWMEFQLZTRTD-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCSSCCOCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)