cas: 2055014-98-5 — see every product listed under this CAS number, including other names
Acid-PEG3-SS-PEG3-acid 95% (CAS 2055014-98-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A756020-50mg |
| cas | 2055014-98-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 370.38 Pln | |
| Ambeed | 100mg | 548.38 Pln | |
| Ambeed | 250mg | 787.56 Pln | |
| Ambeed | 1g | 2222.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A756020 |
3-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethyldisulfanyl]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2055014-98-5) is a chemical compound with the molecular formula C18H34O10S2 and a molecular weight of 474.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethyldisulfanyl]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: DLBWMEFQLZTRTD-UHFFFAOYSA-N.
| Molecular formula | C18H34O10S2 |
|---|---|
| Molecular weight | 474.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethyldisulfanyl]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | DLBWMEFQLZTRTD-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCSSCCOCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)