4,7-Dibromo-1,10-phenanthroline, 97%
cas: 156492-30-7 — see every product listed under this CAS number, including other names
4,7-Dibromo-1,10-phenanthroline, 97% (CAS 156492-30-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A133976-250mg |
| cas | 156492-30-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 1265.94 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 597.20 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 2474.00 Pln | |
| BLDpharm | 100mg | 164.41 Pln | |
| BLDpharm | 250mg | 258.82 Pln | |
| BLDpharm | 1g | 375.45 Pln | |
| BLDpharm | 5g | 1358.44 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4,7-dibromo-1,10-phenanthroline (CAS 156492-30-7) is a chemical compound with the molecular formula C12H6Br2N2 and a molecular weight of 338.00 g/mol. IUPAC name: 4,7-dibromo-1,10-phenanthroline. InChIKey: AKZAIDYHEKUXBU-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2N2 |
|---|---|
| Molecular weight | 338.00 g/mol |
| IUPAC name | 4,7-dibromo-1,10-phenanthroline |
| InChIKey | AKZAIDYHEKUXBU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C3=NC=CC(=C31)Br)Br |
Computed by PubChem (NCBI)