cas: 294874-71-8 — see every product listed under this CAS number, including other names
4,8-Dichloro[1]benzofuro[3,2-d]pyrimidine 97% (CAS 294874-71-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A700242-1g |
| cas | 294874-71-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 25g | 1738.75 Pln | |
| Ambeed | 100g | 5432.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A700242 |
4,8-dichloro-[1]benzofuro[3,2-d]pyrimidine (CAS 294874-71-8) is a chemical compound with the molecular formula C10H4Cl2N2O and a molecular weight of 239.05 g/mol. IUPAC name: 4,8-dichloro-[1]benzofuro[3,2-d]pyrimidine. InChIKey: FLULEERYFWMYDE-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2N2O |
|---|---|
| Molecular weight | 239.05 g/mol |
| IUPAC name | 4,8-dichloro-[1]benzofuro[3,2-d]pyrimidine |
| InChIKey | FLULEERYFWMYDE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C3=C(O2)C(=NC=N3)Cl |
Computed by PubChem (NCBI)