CAS 294874-71-8 appears in our catalog under these names: 4,8-Dichloro[1]benzofuro[3,2-d]pyrimidine, 95%, 4,8-Dichloro[1]benzofuro[3,2-d]pyrimidine 97%, 4,8-Dichlorobenzofuro[3,2-D]Pyrimidine, 97%, 97%, 4,8-dichloro[1]benzofuro[3,2-d]pyrimidine, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g.
4,8-dichloro-[1]benzofuro[3,2-d]pyrimidine (CAS 294874-71-8) is a chemical compound with the molecular formula C10H4Cl2N2O and a molecular weight of 239.05 g/mol. IUPAC name: 4,8-dichloro-[1]benzofuro[3,2-d]pyrimidine. InChIKey: FLULEERYFWMYDE-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2N2O |
|---|---|
| Molecular weight | 239.05 g/mol |
| IUPAC name | 4,8-dichloro-[1]benzofuro[3,2-d]pyrimidine |
| InChIKey | FLULEERYFWMYDE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C3=C(O2)C(=NC=N3)Cl |
Computed by PubChem (NCBI)