cas: 39143-25-4 — see every product listed under this CAS number, including other names
4–Amino–1–benzylpiperidine–4–carboxylic acid (CAS 39143-25-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB55895-10g |
| cas | 39143-25-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 2352.23 Pln | |
| GLPBio | 1g | 634.48 Pln | |
| GLPBio | 25g | 5062.24 Pln | |
| GLPBio | 5g | 1491.02 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-amino-1-benzylpiperidine-4-carboxylic acid (CAS 39143-25-4) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: 4-amino-1-benzylpiperidine-4-carboxylic acid. InChIKey: UAPJXCZSNCQLMR-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 4-amino-1-benzylpiperidine-4-carboxylic acid |
| InChIKey | UAPJXCZSNCQLMR-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(C(=O)O)N)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)