cas: 1070879-27-4 — see every product listed under this CAS number, including other names
4–Bromo–7–methoxyquinoline (CAS 1070879-27-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF26254-10g |
| cas | 1070879-27-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 3232.16 Pln | |
| GLPBio | 1g | 1280.39 Pln | |
| GLPBio | 250mg | 845.11 Pln | |
| GLPBio | 5g | 2296.06 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-bromo-7-methoxyquinoline (CAS 1070879-27-4) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 4-bromo-7-methoxyquinoline. InChIKey: HSLGTRSMCWHZQH-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 4-bromo-7-methoxyquinoline |
| InChIKey | HSLGTRSMCWHZQH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=CC(=C2C=C1)Br |
Computed by PubChem (NCBI)