cas: 1070879-27-4 — see every product listed under this CAS number, including other names
4-Bromo-7-methoxyquinoline, 96%, 96% (CAS 1070879-27-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KZ0-100mg |
| cas | 1070879-27-4 |
| size | 100mg |
| availability | 33g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 976.40 Pln | |
| Chemat | 10g | 1744.40 Pln | |
| Chemat | 25g | 4043.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4-bromo-7-methoxyquinoline (CAS 1070879-27-4) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 4-bromo-7-methoxyquinoline. InChIKey: HSLGTRSMCWHZQH-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 4-bromo-7-methoxyquinoline |
| InChIKey | HSLGTRSMCWHZQH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=CC(=C2C=C1)Br |
Computed by PubChem (NCBI)