cas: 850349-32-5 — see every product listed under this CAS number, including other names
4-((3-Bromophenyl)sulfonyl)thiomorpholine 97% (CAS 850349-32-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A388204-1g |
| cas | 850349-32-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 381.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A388204 |
4-(3-bromophenyl)sulfonylthiomorpholine (CAS 850349-32-5) is a chemical compound with the molecular formula C10H12BrNO2S2 and a molecular weight of 322.2 g/mol. IUPAC name: 4-(3-bromophenyl)sulfonylthiomorpholine. InChIKey: ALQQBRRUKQEDOM-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2S2 |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | 4-(3-bromophenyl)sulfonylthiomorpholine |
| InChIKey | ALQQBRRUKQEDOM-UHFFFAOYSA-N |
| SMILES | C1CSCCN1S(=O)(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)