CAS 850349-32-5 appears in our catalog under these names: 4-(3-Bromo-benzenesulfonyl)-thiomorpholine, 95%, 4-((3-Bromophenyl)sulfonyl)thiomorpholine 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 25g, 5g, 1g.
4-(3-bromophenyl)sulfonylthiomorpholine (CAS 850349-32-5) is a chemical compound with the molecular formula C10H12BrNO2S2 and a molecular weight of 322.2 g/mol. IUPAC name: 4-(3-bromophenyl)sulfonylthiomorpholine. InChIKey: ALQQBRRUKQEDOM-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2S2 |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | 4-(3-bromophenyl)sulfonylthiomorpholine |
| InChIKey | ALQQBRRUKQEDOM-UHFFFAOYSA-N |
| SMILES | C1CSCCN1S(=O)(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)