cas: 1401222-64-7 — see every product listed under this CAS number, including other names
4-((4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)sulfonyl)morpholine 98% (CAS 1401222-64-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A910300-1g |
| cas | 1401222-64-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 837.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A910300 |
4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylmorpholine (CAS 1401222-64-7) is a chemical compound with the molecular formula C16H24BNO5S and a molecular weight of 353.2 g/mol. IUPAC name: 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylmorpholine. InChIKey: ZOTKDMJEHZLGRG-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO5S |
|---|---|
| Molecular weight | 353.2 g/mol |
| IUPAC name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylmorpholine |
| InChIKey | ZOTKDMJEHZLGRG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)N3CCOCC3 |
Computed by PubChem (NCBI)