cas: 1401222-64-7 — see every product listed under this CAS number, including other names
4-(MORPHOLINOSULFONYL)PHENYLBORONIC ACID PINACOL ESTER, 98%, 98% (CAS 1401222-64-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110DEQ-100mg |
| cas | 1401222-64-7 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 122.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylmorpholine (CAS 1401222-64-7) is a chemical compound with the molecular formula C16H24BNO5S and a molecular weight of 353.2 g/mol. IUPAC name: 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylmorpholine. InChIKey: ZOTKDMJEHZLGRG-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO5S |
|---|---|
| Molecular weight | 353.2 g/mol |
| IUPAC name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylmorpholine |
| InChIKey | ZOTKDMJEHZLGRG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)N3CCOCC3 |
Computed by PubChem (NCBI)