cas: 2304634-02-2 — see every product listed under this CAS number, including other names
4-((4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)sulfonyl)piperidine hydrochloride 98+% (CAS 2304634-02-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A633374-100mg |
| cas | 2304634-02-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 592.88 Pln | |
| Ambeed | 250mg | 971.12 Pln | |
| Ambeed | 1g | 2439.62 Pln | |
| Ambeed | 5g | 8385.94 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A633374 |
4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidine;hydrochloride (CAS 2304634-02-2) is a chemical compound with the molecular formula C17H27BClNO4S and a molecular weight of 387.7 g/mol. IUPAC name: 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidine;hydrochloride. InChIKey: KENNGXOYTBZOOX-UHFFFAOYSA-N.
| Molecular formula | C17H27BClNO4S |
|---|---|
| Molecular weight | 387.7 g/mol |
| IUPAC name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidine;hydrochloride |
| InChIKey | KENNGXOYTBZOOX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)C3CCNCC3.Cl |
Computed by PubChem (NCBI)