cas: 2304634-02-2 — see every product listed under this CAS number, including other names
4-[4-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-benzenesulfonyl]piperidine hydrochloride, 98+%, 98+% (CAS 2304634-02-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JP99-100mg |
| cas | 2304634-02-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 250mg | 678.80 Pln | |
| Chemat | 1g | 1888.40 Pln | |
| Chemat | 5g | 7490.00 Pln | |
| Chemat | 10g | 12242.00 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidine;hydrochloride (CAS 2304634-02-2) is a chemical compound with the molecular formula C17H27BClNO4S and a molecular weight of 387.7 g/mol. IUPAC name: 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidine;hydrochloride. InChIKey: KENNGXOYTBZOOX-UHFFFAOYSA-N.
| Molecular formula | C17H27BClNO4S |
|---|---|
| Molecular weight | 387.7 g/mol |
| IUPAC name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidine;hydrochloride |
| InChIKey | KENNGXOYTBZOOX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)C3CCNCC3.Cl |
Computed by PubChem (NCBI)