cas: 364794-85-4 — see every product listed under this CAS number, including other names
4-((4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)methyl)morpholine 97% (CAS 364794-85-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A816030-250mg |
| cas | 364794-85-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 1799.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A816030 |
4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]morpholine (CAS 364794-85-4) is a chemical compound with the molecular formula C15H24BNO3S and a molecular weight of 309.2 g/mol. IUPAC name: 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]morpholine. InChIKey: AMUMGAXTCHBNPU-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO3S |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]morpholine |
| InChIKey | AMUMGAXTCHBNPU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=C2)CN3CCOCC3 |
Computed by PubChem (NCBI)