cas: 3035-94-7 — see every product listed under this CAS number, including other names
4-((4-Bromophenyl)diazenyl)phenol, 98%, 98% (CAS 3035-94-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 200mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ZU5-50mg |
| cas | 3035-94-7 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 213.20 Pln | |
| Chemat | 200mg | 414.80 Pln | |
| Chemat | 1g | 1499.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[(4-bromophenyl)diazenyl]phenol (CAS 3035-94-7) is a chemical compound with the molecular formula C12H9BrN2O and a molecular weight of 277.12 g/mol. IUPAC name: 4-[(4-bromophenyl)diazenyl]phenol. InChIKey: YEBZABRSUREBDG-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O |
|---|---|
| Molecular weight | 277.12 g/mol |
| IUPAC name | 4-[(4-bromophenyl)diazenyl]phenol |
| InChIKey | YEBZABRSUREBDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)