cas: 321432-05-7 — see every product listed under this CAS number, including other names
4-((4-Fluorobenzyl)oxy)-3-methoxybenzaldehyde 98+% (CAS 321432-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A424767-100mg |
| cas | 321432-05-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 748.62 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A424767 |
4-[(4-fluorophenyl)methoxy]-3-methoxybenzaldehyde (CAS 321432-05-7) is a chemical compound with the molecular formula C15H13FO3 and a molecular weight of 260.26 g/mol. IUPAC name: 4-[(4-fluorophenyl)methoxy]-3-methoxybenzaldehyde. InChIKey: PGCCPVWYLPJNBO-UHFFFAOYSA-N.
| Molecular formula | C15H13FO3 |
|---|---|
| Molecular weight | 260.26 g/mol |
| IUPAC name | 4-[(4-fluorophenyl)methoxy]-3-methoxybenzaldehyde |
| InChIKey | PGCCPVWYLPJNBO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OCC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)