cas: 321432-05-7 — see every product listed under this CAS number, including other names
4-[(4-Fluorobenzyl)oxy]-3-methoxybenzaldehyde, 98% (CAS 321432-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010105-100MG |
| cas | 321432-05-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 500mg | 299.91 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 877.83 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-[(4-fluorophenyl)methoxy]-3-methoxybenzaldehyde (CAS 321432-05-7) is a chemical compound with the molecular formula C15H13FO3 and a molecular weight of 260.26 g/mol. IUPAC name: 4-[(4-fluorophenyl)methoxy]-3-methoxybenzaldehyde. InChIKey: PGCCPVWYLPJNBO-UHFFFAOYSA-N.
| Molecular formula | C15H13FO3 |
|---|---|
| Molecular weight | 260.26 g/mol |
| IUPAC name | 4-[(4-fluorophenyl)methoxy]-3-methoxybenzaldehyde |
| InChIKey | PGCCPVWYLPJNBO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OCC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)