cas: 120743-99-9 — see every product listed under this CAS number, including other names
4-((tert-Butyldimethylsilyl)oxy)benzaldehyde 96% (CAS 120743-99-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A638134-250mg |
| cas | 120743-99-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 904.38 Pln | |
| Ambeed | 10g | 1527.38 Pln | |
| Ambeed | 25g | 2984.75 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A638134 |
4-[tert-butyl(dimethyl)silyl]oxybenzaldehyde (CAS 120743-99-9) is a chemical compound with the molecular formula C13H20O2Si and a molecular weight of 236.38 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxybenzaldehyde. InChIKey: XACWSBWCLJXKGI-UHFFFAOYSA-N.
| Molecular formula | C13H20O2Si |
|---|---|
| Molecular weight | 236.38 g/mol |
| IUPAC name | 4-[tert-butyl(dimethyl)silyl]oxybenzaldehyde |
| InChIKey | XACWSBWCLJXKGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)