cas: 214475-53-3 — see every product listed under this CAS number, including other names
4-({[(9H-fluoren-9-ylmethoxy)carbonyl]amino}amino)benzoic acid, 98%, 98% (CAS 214475-53-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JZR-250mg |
| cas | 214475-53-3 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 318.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[2-(9H-fluoren-9-ylmethoxycarbonyl)hydrazinyl]benzoic acid (CAS 214475-53-3) is a chemical compound with the molecular formula C22H18N2O4 and a molecular weight of 374.4 g/mol. IUPAC name: 4-[2-(9H-fluoren-9-ylmethoxycarbonyl)hydrazinyl]benzoic acid. InChIKey: MLVJMSRGLQCZDE-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 4-[2-(9H-fluoren-9-ylmethoxycarbonyl)hydrazinyl]benzoic acid |
| InChIKey | MLVJMSRGLQCZDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NNC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)