CAS 214475-53-3 appears in our catalog under these names: 4-({[(9H-fluoren-9-ylmethoxy)carbonyl]amino}amino)benzoic acid, 98%, 4–(Fmoc–hydrazino)–benzoic acid, Fmoc-4-hydrazinobenzoic acid, Fmoc-4-hydrazinobenzoicacid 98%, 4-({[(9H-fluoren-9-ylmethoxy)carbonyl]amino}amino)benzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 25g, 1g, 10g, 250mg.
4-[2-(9H-fluoren-9-ylmethoxycarbonyl)hydrazinyl]benzoic acid (CAS 214475-53-3) is a chemical compound with the molecular formula C22H18N2O4 and a molecular weight of 374.4 g/mol. IUPAC name: 4-[2-(9H-fluoren-9-ylmethoxycarbonyl)hydrazinyl]benzoic acid. InChIKey: MLVJMSRGLQCZDE-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 4-[2-(9H-fluoren-9-ylmethoxycarbonyl)hydrazinyl]benzoic acid |
| InChIKey | MLVJMSRGLQCZDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NNC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)