cas: 396682-90-9 — see every product listed under this CAS number, including other names
4-(1,7-Naphthyridin-8-ylamino)-4-oxobutanoic acid (CAS 396682-90-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023747-1G |
| cas | 396682-90-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 857.01 Pln | |
| Fluorochem | 5g | 1841.04 Pln |
| delivery time | 2-3 weeks |
|---|
4-(1,7-naphthyridin-8-ylamino)-4-oxobutanoic acid (CAS 396682-90-9) is a chemical compound with the molecular formula C12H11N3O3 and a molecular weight of 245.23 g/mol. IUPAC name: 4-(1,7-naphthyridin-8-ylamino)-4-oxobutanoic acid. InChIKey: QXLLOFROZJRIHD-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 4-(1,7-naphthyridin-8-ylamino)-4-oxobutanoic acid |
| InChIKey | QXLLOFROZJRIHD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=C2)NC(=O)CCC(=O)O)N=C1 |
Computed by PubChem (NCBI)