Products 396682-90-9

CAS 396682-90-9 is the registry number for 4-(1,7-Naphthyridin-8-ylamino)-4-oxobutanoic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(1,7-naphthyridin-8-ylamino)-4-oxobutanoic acid (CAS 396682-90-9) is a chemical compound with the molecular formula C12H11N3O3 and a molecular weight of 245.23 g/mol. IUPAC name: 4-(1,7-naphthyridin-8-ylamino)-4-oxobutanoic acid. InChIKey: QXLLOFROZJRIHD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11N3O3
Molecular weight245.23 g/mol
IUPAC name4-(1,7-naphthyridin-8-ylamino)-4-oxobutanoic acid
InChIKeyQXLLOFROZJRIHD-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=NC=C2)NC(=O)CCC(=O)O)N=C1

Computed by PubChem (NCBI)