CAS 396682-90-9 is the registry number for 4-(1,7-Naphthyridin-8-ylamino)-4-oxobutanoic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
4-(1,7-naphthyridin-8-ylamino)-4-oxobutanoic acid (CAS 396682-90-9) is a chemical compound with the molecular formula C12H11N3O3 and a molecular weight of 245.23 g/mol. IUPAC name: 4-(1,7-naphthyridin-8-ylamino)-4-oxobutanoic acid. InChIKey: QXLLOFROZJRIHD-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 4-(1,7-naphthyridin-8-ylamino)-4-oxobutanoic acid |
| InChIKey | QXLLOFROZJRIHD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=C2)NC(=O)CCC(=O)O)N=C1 |
Computed by PubChem (NCBI)