CAS 885274-47-5 appears in our catalog under these names: 4-(1-Fmoc-piperidin-4-yl)-butyric acid, 98%, Fmoc-Cpp-OH, 4-(1-FMOC-PIPERIDIN-4-YL)-BUTYRIC ACID, 97%, 97%, 4-(1-Fmoc-Piperidin-4-yl)-butyric acid, 97%, 4-(1-Fmoc-piperidin-4-yl)butanoic acid, 97%. Offered by: Combi-blocks, Iris Biotech, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.
4-[1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-4-yl]butanoic acid (CAS 885274-47-5) is a chemical compound with the molecular formula C24H27NO4 and a molecular weight of 393.5 g/mol. IUPAC name: 4-[1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-4-yl]butanoic acid. InChIKey: YYRZYEJDKCYTOM-UHFFFAOYSA-N.
| Molecular formula | C24H27NO4 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | 4-[1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-4-yl]butanoic acid |
| InChIKey | YYRZYEJDKCYTOM-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CCCC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)