cas: 27996-86-7 — see every product listed under this CAS number, including other names
4-(1H-1,2,4-Triazol-1-yl)benzaldehyde, 95% (CAS 27996-86-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F065105-1G |
| cas | 27996-86-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 10g | 200.99 Pln | |
| Fluorochem | 25g | 341.56 Pln | |
| Fluorochem | 100g | 940.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-(1,2,4-triazol-1-yl)benzaldehyde (CAS 27996-86-7) is a chemical compound with the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. IUPAC name: 4-(1,2,4-triazol-1-yl)benzaldehyde. InChIKey: TVEJNWMWDIXPAX-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 4-(1,2,4-triazol-1-yl)benzaldehyde |
| InChIKey | TVEJNWMWDIXPAX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)N2C=NC=N2 |
Computed by PubChem (NCBI)