cas: 4110-15-0 — see every product listed under this CAS number, including other names
4-(1H-Benzo[d]imidazol-2-yl)benzonitrile, 97%, 97% (CAS 4110-15-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CWIH-250mg |
| cas | 4110-15-0 |
| size | 250mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1144.40 Pln | |
| Chemat | 1g | 3309.20 Pln | |
| Chemat | 5g | 12995.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(1H-benzimidazol-2-yl)benzonitrile (CAS 4110-15-0) is a chemical compound with the molecular formula C14H9N3 and a molecular weight of 219.24 g/mol. IUPAC name: 4-(1H-benzimidazol-2-yl)benzonitrile. InChIKey: INIBMZLOCLDDMA-UHFFFAOYSA-N.
| Molecular formula | C14H9N3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 4-(1H-benzimidazol-2-yl)benzonitrile |
| InChIKey | INIBMZLOCLDDMA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)