CAS 2227272-60-6 is the registry number for 6-Ethynyl-8-phenylimidazo[1,2-a]pyrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
6-ethynyl-8-phenylimidazo[1,2-a]pyrazine (CAS 2227272-60-6) is a chemical compound with the molecular formula C14H9N3 and a molecular weight of 219.24 g/mol. IUPAC name: 6-ethynyl-8-phenylimidazo[1,2-a]pyrazine. InChIKey: HMLLCSGHJQUHSS-UHFFFAOYSA-N.
| Molecular formula | C14H9N3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 6-ethynyl-8-phenylimidazo[1,2-a]pyrazine |
| InChIKey | HMLLCSGHJQUHSS-UHFFFAOYSA-N |
| SMILES | C#CC1=CN2C=CN=C2C(=N1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)