Products 910036-84-9

CAS 910036-84-9 is the registry number for 4-(1H-Imidazol-1-ylmethyl)-N-methylbenzylamine 1.5 oxalate 0.5 hydrate, 95% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.

Structural formula: {0} (CAS {1})

1-[4-(imidazol-1-ylmethyl)phenyl]-N-methylmethanamine;oxalic acid (CAS 910036-84-9) is a chemical compound with the molecular formula C14H17N3O4 and a molecular weight of 291.30 g/mol. IUPAC name: 1-[4-(imidazol-1-ylmethyl)phenyl]-N-methylmethanamine;oxalic acid. InChIKey: AIQAEMDKVTYASZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17N3O4
Molecular weight291.30 g/mol
IUPAC name1-[4-(imidazol-1-ylmethyl)phenyl]-N-methylmethanamine;oxalic acid
InChIKeyAIQAEMDKVTYASZ-UHFFFAOYSA-N
SMILESCNCC1=CC=C(C=C1)CN2C=CN=C2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)