CAS 899374-59-5 is the registry number for 1,4-Diacetyl-2,3-dimethyl-6-nitro-1,2,3,4-tetrahydroquinoxaline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(4-acetyl-2,3-dimethyl-6-nitro-2,3-dihydroquinoxalin-1-yl)ethanone (CAS 899374-59-5) is a chemical compound with the molecular formula C14H17N3O4 and a molecular weight of 291.30 g/mol. IUPAC name: 1-(4-acetyl-2,3-dimethyl-6-nitro-2,3-dihydroquinoxalin-1-yl)ethanone. InChIKey: PMTHDUKCVRFGKD-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O4 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | 1-(4-acetyl-2,3-dimethyl-6-nitro-2,3-dihydroquinoxalin-1-yl)ethanone |
| InChIKey | PMTHDUKCVRFGKD-UHFFFAOYSA-N |
| SMILES | CC1C(N(C2=C(N1C(=O)C)C=CC(=C2)[N+](=O)[O-])C(=O)C)C |
Computed by PubChem (NCBI)