cas: 474706-35-9 — see every product listed under this CAS number, including other names
4-(1H-Pyrazol-3-yl)benzonitrile, 98+%, 98+% (CAS 474706-35-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9NI-250mg |
| cas | 474706-35-9 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1874.00 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
4-(1H-pyrazol-5-yl)benzonitrile (CAS 474706-35-9) is a chemical compound with the molecular formula C10H7N3 and a molecular weight of 169.18 g/mol. IUPAC name: 4-(1H-pyrazol-5-yl)benzonitrile. InChIKey: KBVIWLGAVURNLR-UHFFFAOYSA-N.
| Molecular formula | C10H7N3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 4-(1H-pyrazol-5-yl)benzonitrile |
| InChIKey | KBVIWLGAVURNLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC=NN2 |
Computed by PubChem (NCBI)