cas: 86988-50-3 — see every product listed under this CAS number, including other names
4-(2,2,2-Trifluoroacetyl)benzaldehyde 97% (CAS 86988-50-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A694430-100mg |
| cas | 86988-50-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1416.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A694430 |
4-(2,2,2-trifluoroacetyl)benzaldehyde (CAS 86988-50-3) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: 4-(2,2,2-trifluoroacetyl)benzaldehyde. InChIKey: QZIUSAUIKVMLEX-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroacetyl)benzaldehyde |
| InChIKey | QZIUSAUIKVMLEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)