cas: 86988-50-3 — see every product listed under this CAS number, including other names
4-(2,2,2-trifluoroacetyl)benzaldehyde, 97%, 97% (CAS 86988-50-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115KSV-100mg |
| cas | 86988-50-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 568.40 Pln | |
| Chemat | 1g | 1432.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(2,2,2-trifluoroacetyl)benzaldehyde (CAS 86988-50-3) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: 4-(2,2,2-trifluoroacetyl)benzaldehyde. InChIKey: QZIUSAUIKVMLEX-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroacetyl)benzaldehyde |
| InChIKey | QZIUSAUIKVMLEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)