cas: 110931-78-7 — see every product listed under this CAS number, including other names
4-(2,4-Difluorophenyl)butanoic acid, 97% (CAS 110931-78-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F766196-1G |
| cas | 110931-78-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1070.47 Pln | |
| Fluorochem | 5g | 2788.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(2,4-difluorophenyl)butanoic acid (CAS 110931-78-7) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: 4-(2,4-difluorophenyl)butanoic acid. InChIKey: IFFOGNBDGRXWFK-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | 4-(2,4-difluorophenyl)butanoic acid |
| InChIKey | IFFOGNBDGRXWFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CCCC(=O)O |
Computed by PubChem (NCBI)