CAS 1706436-19-2 appears in our catalog under these names: 2',3'-Difluoro-5'-methoxy-4'-methylacetophenone, 95%, 1-(2,3-Difluoro-5-methoxy-4-methylphenyl)ethanone, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 10g.
1-(2,3-difluoro-5-methoxy-4-methylphenyl)ethanone (CAS 1706436-19-2) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: 1-(2,3-difluoro-5-methoxy-4-methylphenyl)ethanone. InChIKey: ATXZTBZNVVQIAR-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | 1-(2,3-difluoro-5-methoxy-4-methylphenyl)ethanone |
| InChIKey | ATXZTBZNVVQIAR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1F)F)C(=O)C)OC |
Computed by PubChem (NCBI)