cas: 221302-75-6 — see every product listed under this CAS number, including other names
4-(2,6-Dimethylphenoxy)phthalonitrile, 99.0%, 99.0% (CAS 221302-75-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JYR-1g |
| cas | 221302-75-6 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 856.40 Pln |
| purity | 99.0% |
|---|---|
| delivery time | 3 weeks |
4-(2,6-dimethylphenoxy)benzene-1,2-dicarbonitrile (CAS 221302-75-6) is a chemical compound with the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. IUPAC name: 4-(2,6-dimethylphenoxy)benzene-1,2-dicarbonitrile. InChIKey: LJUVUOSWARAIBZ-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 4-(2,6-dimethylphenoxy)benzene-1,2-dicarbonitrile |
| InChIKey | LJUVUOSWARAIBZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OC2=CC(=C(C=C2)C#N)C#N |
Computed by PubChem (NCBI)