CAS 112009-28-6 appears in our catalog under these names: 1,5-Diphenyl-1h-pyrazole-3-carbaldehyde, 95%, 1,5-Diphenyl-1H-pyrazole-3-carbaldehyde, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10G, 1g, 250mg, 5g.
1,5-diphenylpyrazole-3-carbaldehyde (CAS 112009-28-6) is a chemical compound with the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. IUPAC name: 1,5-diphenylpyrazole-3-carbaldehyde. InChIKey: KUMVINZWWAVEME-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 1,5-diphenylpyrazole-3-carbaldehyde |
| InChIKey | KUMVINZWWAVEME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NN2C3=CC=CC=C3)C=O |
Computed by PubChem (NCBI)