CAS 68449-31-0 appears in our catalog under these names: 2-Chloro-benzenebutanoic acid, 4-(2-Chlorophenyl)butanoic acid, 98%, 98%, 2-Chlorobenzenebutanoic acid, 98%, 4-(2-Chlorophenyl)butanoic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g, 10g, 25g.
4-(2-chlorophenyl)butanoic acid (CAS 68449-31-0) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 4-(2-chlorophenyl)butanoic acid. InChIKey: JNJQMOCBSVJQSM-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 4-(2-chlorophenyl)butanoic acid |
| InChIKey | JNJQMOCBSVJQSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCCC(=O)O)Cl |
Computed by PubChem (NCBI)