cas: 1073354-74-1 — see every product listed under this CAS number, including other names
4-(2-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)morpholine 97% (CAS 1073354-74-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A133455-100mg |
| cas | 1073354-74-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 2189.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A133455 |
4-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine (CAS 1073354-74-1) is a chemical compound with the molecular formula C17H25BFNO3 and a molecular weight of 321.2 g/mol. IUPAC name: 4-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine. InChIKey: QINFDPZSZHPUSC-UHFFFAOYSA-N.
| Molecular formula | C17H25BFNO3 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 4-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine |
| InChIKey | QINFDPZSZHPUSC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CN3CCOCC3)F |
Computed by PubChem (NCBI)