cas: 921938-78-5 — see every product listed under this CAS number, including other names
4-(2-Methyl-1H-imidazol-1-yl)benzoic acid hydrochloride hydrate, 95% (CAS 921938-78-5) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC61451CB |
| cas | 921938-78-5 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 646.53 Pln | |
| Thermo Scientific | 1g | 1023.25 Pln | |
| Thermo Scientific | 5g | 2051.59 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
4-(2-methylimidazol-1-yl)benzoic acid;hydrochloride (CAS 921938-78-5) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: 4-(2-methylimidazol-1-yl)benzoic acid;hydrochloride. InChIKey: BEEGRPWPKUMZCU-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2 |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | 4-(2-methylimidazol-1-yl)benzoic acid;hydrochloride |
| InChIKey | BEEGRPWPKUMZCU-UHFFFAOYSA-N |
| SMILES | CC1=NC=CN1C2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)