Products 14258-69-6
CAS 14258-69-6 appears in our catalog under these names: 5-(4-Chloro-phenyl)-5-ethyl-imidazolidine-2,4-dione, 95%, 5-(4-Chlorophenyl)-5-ethylimidazolidine-2,4-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-(4-chlorophenyl)-5-ethylimidazolidine-2,4-dione (CAS 14258-69-6) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: 5-(4-chlorophenyl)-5-ethylimidazolidine-2,4-dione. InChIKey: XBVKEJXBZSEZMZ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2 |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-5-ethylimidazolidine-2,4-dione |
| InChIKey | XBVKEJXBZSEZMZ-UHFFFAOYSA-N |
| SMILES | CCC1(C(=O)NC(=O)N1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)