cas: 825619-02-1 — see every product listed under this CAS number, including other names
4-(3,4-Diaminobenzyl)morpholine, 98% (CAS 825619-02-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049430-100MG |
| cas | 825619-02-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 841.39 Pln | |
| Fluorochem | 250mg | 1122.54 Pln | |
| Fluorochem | 1g | 2674.08 Pln | |
| Fluorochem | 5g | 9234.27 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(morpholin-4-ylmethyl)benzene-1,2-diamine (CAS 825619-02-1) is a chemical compound with the molecular formula C11H17N3O and a molecular weight of 207.27 g/mol. IUPAC name: 4-(morpholin-4-ylmethyl)benzene-1,2-diamine. InChIKey: SJVVMEBKHHZICW-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 4-(morpholin-4-ylmethyl)benzene-1,2-diamine |
| InChIKey | SJVVMEBKHHZICW-UHFFFAOYSA-N |
| SMILES | C1COCCN1CC2=CC(=C(C=C2)N)N |
Computed by PubChem (NCBI)