CAS 83473-61-4 is the registry number for N1-(4-Amino-2-methylphenyl)-n2,n2-dimethylglycinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
N-(4-amino-2-methylphenyl)-2-(dimethylamino)acetamide (CAS 83473-61-4) is a chemical compound with the molecular formula C11H17N3O and a molecular weight of 207.27 g/mol. IUPAC name: N-(4-amino-2-methylphenyl)-2-(dimethylamino)acetamide. InChIKey: SRHDPFHMZSFGLP-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | N-(4-amino-2-methylphenyl)-2-(dimethylamino)acetamide |
| InChIKey | SRHDPFHMZSFGLP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)NC(=O)CN(C)C |
Computed by PubChem (NCBI)