4-(3-(Trifluoromethyl)-3H-diazirin-3-yl)piperidine hydrochloride, 98%
cas: 2219407-49-3 — see every product listed under this CAS number, including other names
4-(3-(Trifluoromethyl)-3H-diazirin-3-yl)piperidine hydrochloride, 98% (CAS 2219407-49-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1510692-250mg |
| cas | 2219407-49-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 3084.88 Pln | |
| Ambeed | 1g | 9715.38 Pln | |
| Chemat | 25mg | 722.00 Pln | |
| Chemat | 50mg | 1115.60 Pln | |
| Chemat | 100mg | 1744.40 Pln | |
| Chemat | 250mg | 2752.40 Pln | |
| BLDpharm | 25mg | 780.86 Pln | |
| BLDpharm | 50mg | 1252.92 Pln | |
| BLDpharm | 100mg | 1958.22 Pln | |
| BLDpharm | 250mg | 3018.96 Pln | |
| BLDpharm | 1g | 9522.23 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-[3-(trifluoromethyl)diazirin-3-yl]piperidine;hydrochloride (CAS 2219407-49-3) is a chemical compound with the molecular formula C7H11ClF3N3 and a molecular weight of 229.63 g/mol. IUPAC name: 4-[3-(trifluoromethyl)diazirin-3-yl]piperidine;hydrochloride. InChIKey: ILYDABVRDBCQGH-UHFFFAOYSA-N.
| Molecular formula | C7H11ClF3N3 |
|---|---|
| Molecular weight | 229.63 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)diazirin-3-yl]piperidine;hydrochloride |
| InChIKey | ILYDABVRDBCQGH-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2(N=N2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)