CAS 1431966-31-2 appears in our catalog under these names: 3,5-Dimethyl-1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-amine hydrochloride, 95%, 3,5-Dimethyl-1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-amine hydrochloride, 97%, 97%, 3,5-Dimethyl-1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-amine hydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-amine;hydrochloride (CAS 1431966-31-2) is a chemical compound with the molecular formula C7H11ClF3N3 and a molecular weight of 229.63 g/mol. IUPAC name: 3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-amine;hydrochloride. InChIKey: MXXOATVFAMXFOC-UHFFFAOYSA-N.
| Molecular formula | C7H11ClF3N3 |
|---|---|
| Molecular weight | 229.63 g/mol |
| IUPAC name | 3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-amine;hydrochloride |
| InChIKey | MXXOATVFAMXFOC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(F)(F)F)C)N.Cl |
Computed by PubChem (NCBI)