4-(3-(Trifluoromethyl)phenoxy)piperidine, 95%
cas: 337912-66-0 — see every product listed under this CAS number, including other names
4-(3-(Trifluoromethyl)phenoxy)piperidine, 95% (CAS 337912-66-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A663563-100mg |
| cas | 337912-66-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1393.88 Pln | |
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 653.95 Pln | |
| BLDpharm | 100mg | 169.96 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 464.31 Pln | |
| BLDpharm | 5g | 1497.28 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-[3-(trifluoromethyl)phenoxy]piperidine (CAS 337912-66-0) is a chemical compound with the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. IUPAC name: 4-[3-(trifluoromethyl)phenoxy]piperidine. InChIKey: BYJVBLFZMKBFMT-UHFFFAOYSA-N.
| Molecular formula | C12H14F3NO |
|---|---|
| Molecular weight | 245.24 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)phenoxy]piperidine |
| InChIKey | BYJVBLFZMKBFMT-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)