Products 1787201-13-1
CAS 1787201-13-1 is the registry number for (3R)-1-([3-(Trifluoromethyl)phenyl]methyl)pyrrolidin-3-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(3R)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-ol (CAS 1787201-13-1) is a chemical compound with the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. IUPAC name: (3R)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-ol. InChIKey: LKFUGDILXFUNLB-LLVKDONJSA-N.
| Molecular formula | C12H14F3NO |
|---|---|
| Molecular weight | 245.24 g/mol |
| IUPAC name | (3R)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-ol |
| InChIKey | LKFUGDILXFUNLB-LLVKDONJSA-N |
| SMILES | C1CN(C[C@@H]1O)CC2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)