cas: 1159825-25-8 — see every product listed under this CAS number, including other names
4-(3-Bromophenyl)piperidine hydrochloride, 97%, 97% (CAS 1159825-25-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111HBR-100mg |
| cas | 1159825-25-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 544.40 Pln | |
| Chemat | 5g | 2032.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(3-bromophenyl)piperidine;hydrochloride (CAS 1159825-25-8) is a chemical compound with the molecular formula C11H15BrClN and a molecular weight of 276.60 g/mol. IUPAC name: 4-(3-bromophenyl)piperidine;hydrochloride. InChIKey: ASSSYFRUQWDFMT-UHFFFAOYSA-N.
| Molecular formula | C11H15BrClN |
|---|---|
| Molecular weight | 276.60 g/mol |
| IUPAC name | 4-(3-bromophenyl)piperidine;hydrochloride |
| InChIKey | ASSSYFRUQWDFMT-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)