cas: 1159825-25-8 — see every product listed under this CAS number, including other names
4-(3-Bromo-phenyl)-piperidine hydrochloride, 97% (CAS 1159825-25-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g, 25g, 100mg, 250mg, 2.5g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | ST-1704-1g |
| cas | 1159825-25-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 2.5g | 534.20 Pln | |
| Fluorochem | 5g | 706.02 Pln | |
| Fluorochem | 10g | 1362.04 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-(3-bromophenyl)piperidine;hydrochloride (CAS 1159825-25-8) is a chemical compound with the molecular formula C11H15BrClN and a molecular weight of 276.60 g/mol. IUPAC name: 4-(3-bromophenyl)piperidine;hydrochloride. InChIKey: ASSSYFRUQWDFMT-UHFFFAOYSA-N.
| Molecular formula | C11H15BrClN |
|---|---|
| Molecular weight | 276.60 g/mol |
| IUPAC name | 4-(3-bromophenyl)piperidine;hydrochloride |
| InChIKey | ASSSYFRUQWDFMT-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)