cas: 64465-61-8 — see every product listed under this CAS number, including other names
4-(3-Fluorophenyl)phenol, 97%, 97% (CAS 64465-61-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EBOU-100mg |
| cas | 64465-61-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 1g | 1163.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(3-fluorophenyl)phenol (CAS 64465-61-8) is a chemical compound with the molecular formula C12H9FO and a molecular weight of 188.20 g/mol. IUPAC name: 4-(3-fluorophenyl)phenol. InChIKey: FJMDMKNUDRMOCB-UHFFFAOYSA-N.
| Molecular formula | C12H9FO |
|---|---|
| Molecular weight | 188.20 g/mol |
| IUPAC name | 4-(3-fluorophenyl)phenol |
| InChIKey | FJMDMKNUDRMOCB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)